![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | 2-2-2-3-1-video Lemezes centrifuga szetszerelese.wmv | 2018-12-19 10:53 | 7.1M | |
| ANDRITZ SEPARATION – Krauss-Maffei TSF vacuum drum filter - YouTube (360p).mp4 | 2018-12-19 10:52 | 8.8M | |
| Agarose Gel Electrophoresis.mp4 | 2018-12-19 11:07 | 62M | |
| DOW - Ultrafiltration - Product - English.mp4 | 2018-12-19 10:59 | 14M | |
| Demonstration of isocratic SMB chromatography with the Octaveâ„¢ System - YouTube (360p).mp4 | 2018-12-19 11:01 | 15M | |
| How Does Ultrafiltration Work at Water Recycling Plant.mp4 | 2018-12-19 10:57 | 39M | |
| How Its Made Membrane Filters.mp4 | 2018-12-19 10:54 | 18M | |
| How does a High Speed Centrifugal Spray Dryer work.mp4 | 2018-12-19 11:10 | 58M | |
| Introduction to SMB chromatography - Semba Biosciences tutorial - YouTube (360p).mp4 | 2018-12-19 11:02 | 20M | |
| Movie Chem KS5 Modern Chemical Techniques 12 Capillary Electrophoresis.mp4 | 2018-12-19 11:03 | 14M | |
| Production of SW membranes.mp4 | 2018-12-19 11:00 | 129M | |
| Rotary Vacuum Drum Filter - YouTube (360p).mp4 | 2018-12-19 10:52 | 18M | |
| Spray drying of an emulsion using a Mini Spray-Drier Buchi B-290.mp4 | 2018-12-19 11:14 | 55M | |
| ZeeWeed Ultrafiltration Membranes.mp4 | 2018-12-19 10:55 | 8.2M | |
|
|---|